C24H18F16S2 — CID 139606434
1-[8-(3,5-dimethylphenyl)sulfanyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]sulfanyl-3,5-dimethylbenzene (PubChem CID 139606434) has the molecular formula C24H18F16S2 and a molecular weight of 674.51 g/mol. Its IUPAC name is 1-[8-(3,5-dimethylphenyl)sulfanyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]sulfanyl-3,5-dimethylbenzene.
| Compound Name | 1-[8-(3,5-dimethylphenyl)sulfanyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]sulfanyl-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 139606434 |
| Molecular Formula | C24H18F16S2 |
| Molecular Weight | 674.51 g/mol |
| Exact Mass | 674.06 |
| IUPAC Name | 1-[8-(3,5-dimethylphenyl)sulfanyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]sulfanyl-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(SC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Sc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C24H18F16S2/c1-11-5-12(2)8-15(7-11)41-23(37,38)21(33,34)19(29,30)17(25,26)18(27,28)20(31,32)22(35,36)24(39,40)42-16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | ZGGLNHBGXPKATB-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.51 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|