C23H18F14O2 — CID 139606432
1-[7-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy]-3,5-dimethylbenzene (PubChem CID 139606432) has the molecular formula C23H18F14O2 and a molecular weight of 592.37 g/mol. Its IUPAC name is 1-[7-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy]-3,5-dimethylbenzene.
| Compound Name | 1-[7-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 139606432 |
| Molecular Formula | C23H18F14O2 |
| Molecular Weight | 592.37 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 1-[7-(3,5-dimethylphenoxy)-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Oc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C23H18F14O2/c1-11-5-12(2)8-15(7-11)38-22(34,35)20(30,31)18(26,27)17(24,25)19(28,29)21(32,33)23(36,37)39-16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | FMPDAPYJPHPNPE-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.37 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|