C14H9F11O3 — CID 71672248
(3,5-dimethylphenyl) 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 71672248) has the molecular formula C14H9F11O3 and a molecular weight of 434.20 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | (3,5-dimethylphenyl) 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 71672248 |
| Molecular Formula | C14H9F11O3 |
| Molecular Weight | 434.20 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | (3,5-dimethylphenyl) 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | Cc1cc(C)cc(OC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F11O3/c1-6-3-7(2)5-8(4-6)27-9(26)10(15,12(18,19)20)28-14(24,25)11(16,17)13(21,22)23/h3-5H,1-2H3 |
| InChIKey | OHOAIMMQSQXBAH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.20 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|