C15H11F11O3 — CID 163149169
(2,3,5-trimethylphenyl) (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 163149169) has the molecular formula C15H11F11O3 and a molecular weight of 448.23 g/mol. Its IUPAC name is (2,3,5-trimethylphenyl) (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | (2,3,5-trimethylphenyl) (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 163149169 |
| Molecular Formula | C15H11F11O3 |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | (2,3,5-trimethylphenyl) (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | Cc1cc(C)c(C)c(OC(=O)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F11O3/c1-6-4-7(2)8(3)9(5-6)28-10(27)11(16,13(19,20)21)29-15(25,26)12(17,18)14(22,23)24/h4-5H,1-3H3/t11-/m1/s1 |
| InChIKey | MSBCOGKQWGWSJH-LLVKDONJSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|