C12H6F11NO5 — CID 163153992
N-hydroxy-4-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]oxybenzeneamine oxide (PubChem CID 163153992) has the molecular formula C12H6F11NO5 and a molecular weight of 453.16 g/mol. Its IUPAC name is N-hydroxy-4-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]oxybenzeneamine oxide.
| Compound Name | N-hydroxy-4-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]oxybenzeneamine oxide |
|---|---|
| PubChem CID | 163153992 |
| Molecular Formula | C12H6F11NO5 |
| Molecular Weight | 453.16 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | N-hydroxy-4-[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]oxybenzeneamine oxide |
| SMILES | O=C(Oc1ccc([NH+]([O-])O)cc1)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H6F11NO5/c13-8(10(16,17)18,29-12(22,23)9(14,15)11(19,20)21)7(25)28-6-3-1-5(2-4-6)24(26)27/h1-4,24,26H |
| InChIKey | OKFVEPLZOOLNSM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|