C13H10F9NO2 — CID 71672361
(3,5-dimethylphenyl) N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate (PubChem CID 71672361) has the molecular formula C13H10F9NO2 and a molecular weight of 383.21 g/mol. Its IUPAC name is (3,5-dimethylphenyl) N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate.
| Compound Name | (3,5-dimethylphenyl) N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71672361 |
| Molecular Formula | C13H10F9NO2 |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (3,5-dimethylphenyl) N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate |
| SMILES | Cc1cc(C)cc(OC(=O)NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F9NO2/c1-6-3-7(2)5-8(4-6)25-9(24)23-10(11(14,15)16,12(17,18)19)13(20,21)22/h3-5H,1-2H3,(H,23,24) |
| InChIKey | CIGIZTUQSIJAMX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |