About [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate
[3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate (PubChem CID 142031246) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate.
Analyze [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate?
The IUPAC name of [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate (CID 142031246) is [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate.
What is the SMILES notation for [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate?
The canonical SMILES for [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate is CNC(=O)Oc1cc(C)cc(OC(=O)N(C)C)c1.
What is the InChIKey of [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate?
The InChIKey is XLHKMOYCACFMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-8-5-9(17-11(15)13-2)7-10(6-8)18-12(16)14(3)4/h5-7H,1-4H3,(H,13,15).
What are the key properties of [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate?
[3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate has a molecular weight of 252.27 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-5-(methylcarbamoyloxy)phenyl] N,N-dimethylcarbamate is sourced from PubChem (CID 142031246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).