C11H15NO3S — CID 17521
(3,5-dimethyl-4-methylsulfinylphenyl) N-methylcarbamate (PubChem CID 17521) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is (3,5-dimethyl-4-methylsulfinylphenyl) N-methylcarbamate.
| Compound Name | (3,5-dimethyl-4-methylsulfinylphenyl) N-methylcarbamate |
|---|---|
| PubChem CID | 17521 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | (3,5-dimethyl-4-methylsulfinylphenyl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(C)c(S(C)=O)c(C)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-7-5-9(15-11(13)12-3)6-8(2)10(7)16(4)14/h5-6H,1-4H3,(H,12,13) |
| InChIKey | FNCMBMZOZQAWJA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |