C13H19NO2 — CID 23274278
(3-tert-butyl-5-methylphenyl) N-methylcarbamate (PubChem CID 23274278) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3-tert-butyl-5-methylphenyl) N-methylcarbamate.
| Compound Name | (3-tert-butyl-5-methylphenyl) N-methylcarbamate |
|---|---|
| PubChem CID | 23274278 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3-tert-butyl-5-methylphenyl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-9-6-10(13(2,3)4)8-11(7-9)16-12(15)14-5/h6-8H,1-5H3,(H,14,15) |
| InChIKey | RZHKEMZIQUFPOU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |