C27H45NO4 — CID 23424473
ethyl 4-[2-[3-tert-butyl-5-(methylcarbamoyloxy)phenyl]propan-2-yl]decanoate (PubChem CID 23424473) has the molecular formula C27H45NO4 and a molecular weight of 447.66 g/mol. Its IUPAC name is ethyl 4-[2-[3-tert-butyl-5-(methylcarbamoyloxy)phenyl]propan-2-yl]decanoate.
| Compound Name | ethyl 4-[2-[3-tert-butyl-5-(methylcarbamoyloxy)phenyl]propan-2-yl]decanoate |
|---|---|
| PubChem CID | 23424473 |
| Molecular Formula | C27H45NO4 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | ethyl 4-[2-[3-tert-butyl-5-(methylcarbamoyloxy)phenyl]propan-2-yl]decanoate |
| SMILES | CCCCCCC(CCC(=O)OCC)C(C)(C)c1cc(OC(=O)NC)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H45NO4/c1-9-11-12-13-14-20(15-16-24(29)31-10-2)27(6,7)22-17-21(26(3,4)5)18-23(19-22)32-25(30)28-8/h17-20H,9-16H2,1-8H3,(H,28,30) |
| InChIKey | GLXLBPSBFPVGIM-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|