C13H11F8NO2 — CID 87064360
[3-(1,1,1,3,3,4,4,4-octafluoro-2-methylbutan-2-yl)phenyl] N-methylcarbamate (PubChem CID 87064360) has the molecular formula C13H11F8NO2 and a molecular weight of 365.22 g/mol. Its IUPAC name is [3-(1,1,1,3,3,4,4,4-octafluoro-2-methylbutan-2-yl)phenyl] N-methylcarbamate.
| Compound Name | [3-(1,1,1,3,3,4,4,4-octafluoro-2-methylbutan-2-yl)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 87064360 |
| Molecular Formula | C13H11F8NO2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [3-(1,1,1,3,3,4,4,4-octafluoro-2-methylbutan-2-yl)phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc(C(C)(C(F)(F)F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F8NO2/c1-10(12(16,17)18,11(14,15)13(19,20)21)7-4-3-5-8(6-7)24-9(23)22-2/h3-6H,1-2H3,(H,22,23) |
| InChIKey | CBTJYCRTPSJRLC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|