C15H18N2O2 — CID 134111730
[4-(2,5-dimethylpyrrol-1-yl)-3-methylphenyl] N-methylcarbamate (PubChem CID 134111730) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrrol-1-yl)-3-methylphenyl] N-methylcarbamate.
| Compound Name | [4-(2,5-dimethylpyrrol-1-yl)-3-methylphenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 134111730 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [4-(2,5-dimethylpyrrol-1-yl)-3-methylphenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(-n2c(C)ccc2C)c(C)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-10-9-13(19-15(18)16-4)7-8-14(10)17-11(2)5-6-12(17)3/h5-9H,1-4H3,(H,16,18) |
| InChIKey | UJNSFUFKDPYSTM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|