C11H11Cl2NO2 — CID 117060207
[3-(2,2-dichloroethenyl)-4-methylphenyl] N-methylcarbamate (PubChem CID 117060207) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is [3-(2,2-dichloroethenyl)-4-methylphenyl] N-methylcarbamate.
| Compound Name | [3-(2,2-dichloroethenyl)-4-methylphenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 117060207 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | [3-(2,2-dichloroethenyl)-4-methylphenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(C)c(C=C(Cl)Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO2/c1-7-3-4-9(16-11(15)14-2)5-8(7)6-10(12)13/h3-6H,1-2H3,(H,14,15) |
| InChIKey | GWHRPLJKIBGRIH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |