C12H14N2O2 — CID 174591659
(4-amino-3,5-dimethylphenyl) N-prop-2-ynylcarbamate (PubChem CID 174591659) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (4-amino-3,5-dimethylphenyl) N-prop-2-ynylcarbamate.
| Compound Name | (4-amino-3,5-dimethylphenyl) N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 174591659 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (4-amino-3,5-dimethylphenyl) N-prop-2-ynylcarbamate |
| SMILES | C#CCNC(=O)Oc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-4-5-14-12(15)16-10-6-8(2)11(13)9(3)7-10/h1,6-7H,5,13H2,2-3H3,(H,14,15) |
| InChIKey | MVBWJUBQWQGJIH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|