C17H19NO6 — CID 8886180
diethyl 5-[2-oxo-2-(prop-2-ynylamino)ethoxy]benzene-1,3-dicarboxylate (PubChem CID 8886180) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is diethyl 5-[2-oxo-2-(prop-2-ynylamino)ethoxy]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[2-oxo-2-(prop-2-ynylamino)ethoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8886180 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | diethyl 5-[2-oxo-2-(prop-2-ynylamino)ethoxy]benzene-1,3-dicarboxylate |
| SMILES | C#CCNC(=O)COc1cc(C(=O)OCC)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C17H19NO6/c1-4-7-18-15(19)11-24-14-9-12(16(20)22-5-2)8-13(10-14)17(21)23-6-3/h1,8-10H,5-7,11H2,2-3H3,(H,18,19) |
| InChIKey | CNBYHQXBMSGVBQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|