C14H15NO5 — CID 9228714
[2-oxo-2-(prop-2-ynylamino)ethyl] 3,5-dimethoxybenzoate (PubChem CID 9228714) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 9228714 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 3,5-dimethoxybenzoate |
| SMILES | C#CCNC(=O)COC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H15NO5/c1-4-5-15-13(16)9-20-14(17)10-6-11(18-2)8-12(7-10)19-3/h1,6-8H,5,9H2,2-3H3,(H,15,16) |
| InChIKey | RHBGFGKNXDQENG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|