C20H23NO5S — CID 7874743
[2-(2-benzylsulfanylethylamino)-2-oxoethyl] 3,5-dimethoxybenzoate (PubChem CID 7874743) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is [2-(2-benzylsulfanylethylamino)-2-oxoethyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7874743 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCC(=O)NCCSCc2ccccc2)c1 |
| InChI | InChI=1S/C20H23NO5S/c1-24-17-10-16(11-18(12-17)25-2)20(23)26-13-19(22)21-8-9-27-14-15-6-4-3-5-7-15/h3-7,10-12H,8-9,13-14H2,1-2H3,(H,21,22) |
| InChIKey | BLTZPQYYMJVVST-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|