C18H19N3O5S — CID 7569882
[2-(2-benzylsulfanylethylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 7569882) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is [2-(2-benzylsulfanylethylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 7569882 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)NCCSCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O5S/c19-15-7-6-14(10-16(15)21(24)25)18(23)26-11-17(22)20-8-9-27-12-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12,19H2,(H,20,22) |
| InChIKey | FLDXKOUKOKJENG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|