C12H15ClOS — CID 82041694
2-(3,5-dimethylphenyl)sulfanyl-2-methylpropanoyl chloride (PubChem CID 82041694) has the molecular formula C12H15ClOS and a molecular weight of 242.77 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)sulfanyl-2-methylpropanoyl chloride.
| Compound Name | 2-(3,5-dimethylphenyl)sulfanyl-2-methylpropanoyl chloride |
|---|---|
| PubChem CID | 82041694 |
| Molecular Formula | C12H15ClOS |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(3,5-dimethylphenyl)sulfanyl-2-methylpropanoyl chloride |
| SMILES | Cc1cc(C)cc(SC(C)(C)C(=O)Cl)c1 |
| InChI | InChI=1S/C12H15ClOS/c1-8-5-9(2)7-10(6-8)15-12(3,4)11(13)14/h5-7H,1-4H3 |
| InChIKey | SSDWTWTYBQGEEN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|