C15H24S — CID 90837156
1-(2,3-dimethylbut-3-en-2-ylsulfanyl)-3-methylbenzene;ethane (PubChem CID 90837156) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is 1-(2,3-dimethylbut-3-en-2-ylsulfanyl)-3-methylbenzene;ethane.
| Compound Name | 1-(2,3-dimethylbut-3-en-2-ylsulfanyl)-3-methylbenzene;ethane |
|---|---|
| PubChem CID | 90837156 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(2,3-dimethylbut-3-en-2-ylsulfanyl)-3-methylbenzene;ethane |
| SMILES | C=C(C)C(C)(C)Sc1cccc(C)c1.CC |
| InChI | InChI=1S/C13H18S.C2H6/c1-10(2)13(4,5)14-12-8-6-7-11(3)9-12;1-2/h6-9H,1H2,2-5H3;1-2H3 |
| InChIKey | MLYLVHYZHWURAC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|