C16H24N2OS — CID 92922974
1-(4-aminopiperidin-1-yl)-2-methyl-2-(3-methylphenyl)sulfanylpropan-1-one (PubChem CID 92922974) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-2-methyl-2-(3-methylphenyl)sulfanylpropan-1-one.
| Compound Name | 1-(4-aminopiperidin-1-yl)-2-methyl-2-(3-methylphenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 92922974 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-2-methyl-2-(3-methylphenyl)sulfanylpropan-1-one |
| SMILES | Cc1cccc(SC(C)(C)C(=O)N2CCC(N)CC2)c1 |
| InChI | InChI=1S/C16H24N2OS/c1-12-5-4-6-14(11-12)20-16(2,3)15(19)18-9-7-13(17)8-10-18/h4-6,11,13H,7-10,17H2,1-3H3 |
| InChIKey | JRHRXCWZOLXTMP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |