C13H18O2S — CID 82292262
2-methyl-2-(2,4,6-trimethylphenyl)sulfanylpropanoic acid (PubChem CID 82292262) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-methyl-2-(2,4,6-trimethylphenyl)sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-(2,4,6-trimethylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 82292262 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-methyl-2-(2,4,6-trimethylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1cc(C)c(SC(C)(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C13H18O2S/c1-8-6-9(2)11(10(3)7-8)16-13(4,5)12(14)15/h6-7H,1-5H3,(H,14,15) |
| InChIKey | FYELZDZMJCTRSI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |