C16H14F2S — CID 102528016
(1,1-difluoro-2-phenylbut-3-enyl)sulfanylbenzene (PubChem CID 102528016) has the molecular formula C16H14F2S and a molecular weight of 276.35 g/mol. Its IUPAC name is (1,1-difluoro-2-phenylbut-3-enyl)sulfanylbenzene.
| Compound Name | (1,1-difluoro-2-phenylbut-3-enyl)sulfanylbenzene |
|---|---|
| PubChem CID | 102528016 |
| Molecular Formula | C16H14F2S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (1,1-difluoro-2-phenylbut-3-enyl)sulfanylbenzene |
| SMILES | C=CC(c1ccccc1)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C16H14F2S/c1-2-15(13-9-5-3-6-10-13)16(17,18)19-14-11-7-4-8-12-14/h2-12,15H,1H2 |
| InChIKey | ZZYNVXONFFQXEE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|