C10H9Cl3 — CID 71393559
1,1,1-trichlorobut-3-en-2-ylbenzene (PubChem CID 71393559) has the molecular formula C10H9Cl3 and a molecular weight of 235.54 g/mol. Its IUPAC name is 1,1,1-trichlorobut-3-en-2-ylbenzene.
| Compound Name | 1,1,1-trichlorobut-3-en-2-ylbenzene |
|---|---|
| PubChem CID | 71393559 |
| Molecular Formula | C10H9Cl3 |
| Molecular Weight | 235.54 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 1,1,1-trichlorobut-3-en-2-ylbenzene |
| SMILES | C=CC(c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl3/c1-2-9(10(11,12)13)8-6-4-3-5-7-8/h2-7,9H,1H2 |
| InChIKey | XBZHYVFPDGYMCL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|