C21H15F3OS3 — CID 71347290
1,1,1-trifluoro-3,3,3-tris(phenylsulfanyl)propan-2-one (PubChem CID 71347290) has the molecular formula C21H15F3OS3 and a molecular weight of 436.55 g/mol. Its IUPAC name is 1,1,1-trifluoro-3,3,3-tris(phenylsulfanyl)propan-2-one.
| Compound Name | 1,1,1-trifluoro-3,3,3-tris(phenylsulfanyl)propan-2-one |
|---|---|
| PubChem CID | 71347290 |
| Molecular Formula | C21H15F3OS3 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 1,1,1-trifluoro-3,3,3-tris(phenylsulfanyl)propan-2-one |
| SMILES | O=C(C(F)(F)F)C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C21H15F3OS3/c22-20(23,24)19(25)21(26-16-10-4-1-5-11-16,27-17-12-6-2-7-13-17)28-18-14-8-3-9-15-18/h1-15H |
| InChIKey | GERNFIVXMAAEIU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|