C23H19F3O2S3 — CID 88768344
4,4,4-tris(phenylsulfanyl)-3-(trifluoromethyl)butanoic acid (PubChem CID 88768344) has the molecular formula C23H19F3O2S3 and a molecular weight of 480.60 g/mol. Its IUPAC name is 4,4,4-tris(phenylsulfanyl)-3-(trifluoromethyl)butanoic acid.
| Compound Name | 4,4,4-tris(phenylsulfanyl)-3-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 88768344 |
| Molecular Formula | C23H19F3O2S3 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 4,4,4-tris(phenylsulfanyl)-3-(trifluoromethyl)butanoic acid |
| SMILES | O=C(O)CC(C(F)(F)F)C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C23H19F3O2S3/c24-22(25,26)20(16-21(27)28)23(29-17-10-4-1-5-11-17,30-18-12-6-2-7-13-18)31-19-14-8-3-9-15-19/h1-15,20H,16H2,(H,27,28) |
| InChIKey | FOGUPKQNQLFOIZ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|