C16H18F3NO4S — CID 19938440
3-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-phenylbutanoic acid (PubChem CID 19938440) has the molecular formula C16H18F3NO4S and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-phenylbutanoic acid.
| Compound Name | 3-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 19938440 |
| Molecular Formula | C16H18F3NO4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-phenylbutanoic acid |
| SMILES | CC(=O)SCC(C(=O)NC(CC(=O)O)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO4S/c1-10(21)25-9-13(16(17,18)19)15(24)20-12(8-14(22)23)7-11-5-3-2-4-6-11/h2-6,12-13H,7-9H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | VTMZYWZBHVSTGG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|