C16H23N3O2S — CID 22905495
S-[3-phenyl-2-(piperazine-1-carbonylamino)propyl] ethanethioate (PubChem CID 22905495) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is S-[3-phenyl-2-(piperazine-1-carbonylamino)propyl] ethanethioate.
| Compound Name | S-[3-phenyl-2-(piperazine-1-carbonylamino)propyl] ethanethioate |
|---|---|
| PubChem CID | 22905495 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | S-[3-phenyl-2-(piperazine-1-carbonylamino)propyl] ethanethioate |
| SMILES | CC(=O)SCC(Cc1ccccc1)NC(=O)N1CCNCC1 |
| InChI | InChI=1S/C16H23N3O2S/c1-13(20)22-12-15(11-14-5-3-2-4-6-14)18-16(21)19-9-7-17-8-10-19/h2-6,15,17H,7-12H2,1H3,(H,18,21) |
| InChIKey | LWQSOWLDMIZNPJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|