C22H33NO4S — CID 88726693
(2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-2-tert-butyl-4-methylpentanoic acid (PubChem CID 88726693) has the molecular formula C22H33NO4S and a molecular weight of 407.58 g/mol. Its IUPAC name is (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-2-tert-butyl-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-2-tert-butyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 88726693 |
| Molecular Formula | C22H33NO4S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-2-tert-butyl-4-methylpentanoic acid |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)N[C@](CC(C)C)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C22H33NO4S/c1-15(2)13-22(20(26)27,21(4,5)6)23-19(25)18(14-28-16(3)24)12-17-10-8-7-9-11-17/h7-11,15,18H,12-14H2,1-6H3,(H,23,25)(H,26,27)/t18?,22-/m1/s1 |
| InChIKey | AWAJEBXBWOULFE-LMNIDFBRSA-N |
| XLogP | 4.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|