C25H21F6O3P — CID 10097977
2,2,2-trifluoroacetate;triphenyl-(4,4,4-trifluoro-2-methyl-3-oxobutan-2-yl)phosphanium (PubChem CID 10097977) has the molecular formula C25H21F6O3P and a molecular weight of 514.40 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;triphenyl-(4,4,4-trifluoro-2-methyl-3-oxobutan-2-yl)phosphanium.
| Compound Name | 2,2,2-trifluoroacetate;triphenyl-(4,4,4-trifluoro-2-methyl-3-oxobutan-2-yl)phosphanium |
|---|---|
| PubChem CID | 10097977 |
| Molecular Formula | C25H21F6O3P |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 2,2,2-trifluoroacetate;triphenyl-(4,4,4-trifluoro-2-methyl-3-oxobutan-2-yl)phosphanium |
| SMILES | CC(C)(C(=O)C(F)(F)F)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H21F3OP.C2HF3O2/c1-22(2,21(27)23(24,25)26)28(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;3-2(4,5)1(6)7/h3-17H,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | KHVZYZHZSKXPSJ-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|