About 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene
1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene (PubChem CID 102074972) has the molecular formula C11H11F3S
and a molecular weight of 232.27 g/mol. Its IUPAC name is 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene.
Molecular Properties
| Compound Name | 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene |
| PubChem CID | 102074972 |
| Molecular Formula | C11H11F3S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene |
| SMILES | C/C(=C\C(F)(F)F)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C11H11F3S/c1-8-3-5-10(6-4-8)15-9(2)7-11(12,13)14/h3-7H,1-2H3/b9-7+ |
| InChIKey | ZQHHENHAKFZRBP-VQHVLOKHSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene?
The IUPAC name of 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene (CID 102074972) is 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene.
What is the SMILES notation for 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene?
The canonical SMILES for 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene is C/C(=C\C(F)(F)F)Sc1ccc(C)cc1.
What is the InChIKey of 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene?
The InChIKey is ZQHHENHAKFZRBP-VQHVLOKHSA-N. The full InChI is InChI=1S/C11H11F3S/c1-8-3-5-10(6-4-8)15-9(2)7-11(12,13)14/h3-7H,1-2H3/b9-7+.
What are the key properties of 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene?
1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene has a molecular weight of 232.27 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(E)-4,4,4-trifluorobut-2-en-2-yl]sulfanylbenzene is sourced from PubChem (CID 102074972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).