About tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane
tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane (PubChem CID 135076440) has the molecular formula C22H35F3SSn
and a molecular weight of 507.29 g/mol. Its IUPAC name is tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane.
Molecular Properties
| Compound Name | tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane |
| PubChem CID | 135076440 |
| Molecular Formula | C22H35F3SSn |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\C(F)(F)F)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C10H8F3S.3C4H9.Sn/c1-8-2-4-9(5-3-8)14-7-6-10(11,12)13;3*1-3-4-2;/h2-6H,1H3;3*1,3-4H2,2H3; |
| InChIKey | DFCWMDITOHKSNR-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane?
The IUPAC name of tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane (CID 135076440) is tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane.
What is the SMILES notation for tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane?
The canonical SMILES for tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane is CCCC[Sn](CCCC)(CCCC)/C(=C\C(F)(F)F)Sc1ccc(C)cc1.
What is the InChIKey of tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane?
The InChIKey is DFCWMDITOHKSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3S.3C4H9.Sn/c1-8-2-4-9(5-3-8)14-7-6-10(11,12)13;3*1-3-4-2;/h2-6H,1H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane?
tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane has a molecular weight of 507.29 g/mol, XLogP of 8.92, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(Z)-3,3,3-trifluoro-1-(4-methylphenyl)sulfanylprop-1-enyl]stannane is sourced from PubChem (CID 135076440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).