About S-(4-tert-butylphenyl) 2-tributylstannylethanethioate
S-(4-tert-butylphenyl) 2-tributylstannylethanethioate (PubChem CID 88790821) has the molecular formula C24H42OSSn
and a molecular weight of 497.38 g/mol. Its IUPAC name is S-(4-tert-butylphenyl) 2-tributylstannylethanethioate.
Molecular Properties
| Compound Name | S-(4-tert-butylphenyl) 2-tributylstannylethanethioate |
| PubChem CID | 88790821 |
| Molecular Formula | C24H42OSSn |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | S-(4-tert-butylphenyl) 2-tributylstannylethanethioate |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC(=O)Sc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H15OS.3C4H9.Sn/c1-9(13)14-11-7-5-10(6-8-11)12(2,3)4;3*1-3-4-2;/h5-8H,1H2,2-4H3;3*1,3-4H2,2H3; |
| InChIKey | PIUPYKHHAYIWGG-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-tert-butylphenyl) 2-tributylstannylethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-tert-butylphenyl) 2-tributylstannylethanethioate?
The IUPAC name of S-(4-tert-butylphenyl) 2-tributylstannylethanethioate (CID 88790821) is S-(4-tert-butylphenyl) 2-tributylstannylethanethioate.
What is the SMILES notation for S-(4-tert-butylphenyl) 2-tributylstannylethanethioate?
The canonical SMILES for S-(4-tert-butylphenyl) 2-tributylstannylethanethioate is CCCC[Sn](CCCC)(CCCC)CC(=O)Sc1ccc(C(C)(C)C)cc1.
What is the InChIKey of S-(4-tert-butylphenyl) 2-tributylstannylethanethioate?
The InChIKey is PIUPYKHHAYIWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15OS.3C4H9.Sn/c1-9(13)14-11-7-5-10(6-8-11)12(2,3)4;3*1-3-4-2;/h5-8H,1H2,2-4H3;3*1,3-4H2,2H3;.
What are the key properties of S-(4-tert-butylphenyl) 2-tributylstannylethanethioate?
S-(4-tert-butylphenyl) 2-tributylstannylethanethioate has a molecular weight of 497.38 g/mol, XLogP of 8.45, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-tert-butylphenyl) 2-tributylstannylethanethioate is sourced from PubChem (CID 88790821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).