About S-(4-chlorophenyl) decanethioate
S-(4-chlorophenyl) decanethioate (PubChem CID 71395565) has the molecular formula C16H23ClOS
and a molecular weight of 298.88 g/mol. Its IUPAC name is S-(4-chlorophenyl) decanethioate.
Molecular Properties
| Compound Name | S-(4-chlorophenyl) decanethioate |
| PubChem CID | 71395565 |
| Molecular Formula | C16H23ClOS |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | S-(4-chlorophenyl) decanethioate |
| SMILES | CCCCCCCCCC(=O)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23ClOS/c1-2-3-4-5-6-7-8-9-16(18)19-15-12-10-14(17)11-13-15/h10-13H,2-9H2,1H3 |
| InChIKey | CYISFOKLOSGXDM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-chlorophenyl) decanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-chlorophenyl) decanethioate?
The IUPAC name of S-(4-chlorophenyl) decanethioate (CID 71395565) is S-(4-chlorophenyl) decanethioate.
What is the SMILES notation for S-(4-chlorophenyl) decanethioate?
The canonical SMILES for S-(4-chlorophenyl) decanethioate is CCCCCCCCCC(=O)Sc1ccc(Cl)cc1.
What is the InChIKey of S-(4-chlorophenyl) decanethioate?
The InChIKey is CYISFOKLOSGXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClOS/c1-2-3-4-5-6-7-8-9-16(18)19-15-12-10-14(17)11-13-15/h10-13H,2-9H2,1H3.
What are the key properties of S-(4-chlorophenyl) decanethioate?
S-(4-chlorophenyl) decanethioate has a molecular weight of 298.88 g/mol, XLogP of 6.10, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-chlorophenyl) decanethioate is sourced from PubChem (CID 71395565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).