C15H22ClN3O2 — CID 4170220
N-{[(4-chlorophenyl)amino]carbonylamino}octanamide (PubChem CID 4170220) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(octanoylamino)urea.
| Compound Name | N-{[(4-chlorophenyl)amino]carbonylamino}octanamide |
|---|---|
| PubChem CID | 4170220 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(octanoylamino)urea |
| SMILES | CCCCCCCC(=O)NNC(=O)NC1=CC=C(C=C1)Cl |
| InChI | InChI=1S/C15H22ClN3O2/c1-2-3-4-5-6-7-14(20)18-19-15(21)17-13-10-8-12(16)9-11-13/h8-11H,2-7H2,1H3,(H,18,20)(H2,17,19,21) |
| InChIKey | NYUOKXRTLQHDQL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | 318 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|