C17H15Cl3O2S — CID 18848365
S-(4-chlorophenyl) 4-butoxy-3,5-dichlorobenzenecarbothioate (PubChem CID 18848365) has the molecular formula C17H15Cl3O2S and a molecular weight of 389.73 g/mol. Its IUPAC name is S-(4-chlorophenyl) 4-butoxy-3,5-dichlorobenzenecarbothioate.
| Compound Name | S-(4-chlorophenyl) 4-butoxy-3,5-dichlorobenzenecarbothioate |
|---|---|
| PubChem CID | 18848365 |
| Molecular Formula | C17H15Cl3O2S |
| Molecular Weight | 389.73 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | S-(4-chlorophenyl) 4-butoxy-3,5-dichlorobenzenecarbothioate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Sc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C17H15Cl3O2S/c1-2-3-8-22-16-14(19)9-11(10-15(16)20)17(21)23-13-6-4-12(18)5-7-13/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | ATMVJXUPXTVGGW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.73 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|