C22H22Cl3N3O2S2 — CID 18864880
3,5-dichloro-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hexoxybenzamide (PubChem CID 18864880) has the molecular formula C22H22Cl3N3O2S2 and a molecular weight of 530.93 g/mol. Its IUPAC name is 3,5-dichloro-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hexoxybenzamide.
| Compound Name | 3,5-dichloro-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 18864880 |
| Molecular Formula | C22H22Cl3N3O2S2 |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | 3,5-dichloro-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)Nc2nnc(SCc3ccc(Cl)cc3)s2)cc1Cl |
| InChI | InChI=1S/C22H22Cl3N3O2S2/c1-2-3-4-5-10-30-19-17(24)11-15(12-18(19)25)20(29)26-21-27-28-22(32-21)31-13-14-6-8-16(23)9-7-14/h6-9,11-12H,2-5,10,13H2,1H3,(H,26,27,29) |
| InChIKey | OMCDVCWJTBJXPQ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|