C32H32Cl4O6 — CID 71127936
[(2S,3R)-3-(4-butoxy-3,5-dichlorobenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 4-butoxy-3,5-dichlorobenzoate (PubChem CID 71127936) has the molecular formula C32H32Cl4O6 and a molecular weight of 654.41 g/mol. Its IUPAC name is [(2S,3R)-3-(4-butoxy-3,5-dichlorobenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 4-butoxy-3,5-dichlorobenzoate.
| Compound Name | [(2S,3R)-3-(4-butoxy-3,5-dichlorobenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 4-butoxy-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 71127936 |
| Molecular Formula | C32H32Cl4O6 |
| Molecular Weight | 654.41 g/mol |
| Exact Mass | 652.10 |
| IUPAC Name | [(2S,3R)-3-(4-butoxy-3,5-dichlorobenzoyl)oxy-1,2,3,4-tetrahydronaphthalen-2-yl] 4-butoxy-3,5-dichlorobenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)O[C@H]2Cc3ccccc3C[C@H]2OC(=O)c2cc(Cl)c(OCCCC)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C32H32Cl4O6/c1-3-5-11-39-29-23(33)13-21(14-24(29)34)31(37)41-27-17-19-9-7-8-10-20(19)18-28(27)42-32(38)22-15-25(35)30(26(36)16-22)40-12-6-4-2/h7-10,13-16,27-28H,3-6,11-12,17-18H2,1-2H3/t27-,28+ |
| InChIKey | LCGRRHSMYBDBFX-HNRBIFIRSA-N |
| XLogP | 9.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.41 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|