(4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate

C19H20Cl2O4 — CID 18848445

IUPAC(4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate
SMILESCCCCCOc1c(Cl)cc(C(=O)Oc2ccc(OC)cc2)cc1Cl
InChIInChI=1S/C19H20Cl2O4/c1-3-4-5-10-24-18-16(20)11-13(12-17(18)21)19(22)25-15-8-6-14(23-2)7-9-15/h6-9,11-12H,3-5,10H2,1-2H3
InChIKeyHLUXDTVPXJZVPB-UHFFFAOYSA-N
MW383.27 g/mol
LogP5.79
Rot. Bonds8

About (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate

(4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate (PubChem CID 18848445) has the molecular formula C19H20Cl2O4 and a molecular weight of 383.27 g/mol. Its IUPAC name is (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate.

Molecular Properties

Compound Name(4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate
PubChem CID18848445
Molecular FormulaC19H20Cl2O4
Molecular Weight383.27 g/mol
Exact Mass382.07
IUPAC Name(4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate
SMILESCCCCCOc1c(Cl)cc(C(=O)Oc2ccc(OC)cc2)cc1Cl
InChIInChI=1S/C19H20Cl2O4/c1-3-4-5-10-24-18-16(20)11-13(12-17(18)21)19(22)25-15-8-6-14(23-2)7-9-15/h6-9,11-12H,3-5,10H2,1-2H3
InChIKeyHLUXDTVPXJZVPB-UHFFFAOYSA-N
XLogP5.79
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500383.27
LogP ≤ 55.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate?
The IUPAC name of (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate (CID 18848445) is (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate.
What is the SMILES notation for (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate?
The canonical SMILES for (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate is CCCCCOc1c(Cl)cc(C(=O)Oc2ccc(OC)cc2)cc1Cl.
What is the InChIKey of (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate?
The InChIKey is HLUXDTVPXJZVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2O4/c1-3-4-5-10-24-18-16(20)11-13(12-17(18)21)19(22)25-15-8-6-14(23-2)7-9-15/h6-9,11-12H,3-5,10H2,1-2H3.
What are the key properties of (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate?
(4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate has a molecular weight of 383.27 g/mol, XLogP of 5.79, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 3,5-dichloro-4-pentoxybenzoate is sourced from PubChem (CID 18848445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).