C21H25Cl2NO4 — CID 18848493
3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-hexoxybenzamide (PubChem CID 18848493) has the molecular formula C21H25Cl2NO4 and a molecular weight of 426.34 g/mol. Its IUPAC name is 3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-hexoxybenzamide.
| Compound Name | 3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-hexoxybenzamide |
|---|---|
| PubChem CID | 18848493 |
| Molecular Formula | C21H25Cl2NO4 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-hexoxybenzamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)Nc2cc(OC)ccc2OC)cc1Cl |
| InChI | InChI=1S/C21H25Cl2NO4/c1-4-5-6-7-10-28-20-16(22)11-14(12-17(20)23)21(25)24-18-13-15(26-2)8-9-19(18)27-3/h8-9,11-13H,4-7,10H2,1-3H3,(H,24,25) |
| InChIKey | FUSXORABUFEAMK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|