C20H24ClNO3 — CID 18288959
4-butoxy-3-chloro-N-(2,6-dimethylphenyl)-5-methoxybenzamide (PubChem CID 18288959) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is 4-butoxy-3-chloro-N-(2,6-dimethylphenyl)-5-methoxybenzamide.
| Compound Name | 4-butoxy-3-chloro-N-(2,6-dimethylphenyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 18288959 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4-butoxy-3-chloro-N-(2,6-dimethylphenyl)-5-methoxybenzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2c(C)cccc2C)cc1OC |
| InChI | InChI=1S/C20H24ClNO3/c1-5-6-10-25-19-16(21)11-15(12-17(19)24-4)20(23)22-18-13(2)8-7-9-14(18)3/h7-9,11-12H,5-6,10H2,1-4H3,(H,22,23) |
| InChIKey | NEIOCKXTWVVNOH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|