C24H37ClO2S — CID 56935545
S-(3-chlorophenyl) (Z,12R)-12-hydroxyoctadec-9-enethioate (PubChem CID 56935545) has the molecular formula C24H37ClO2S and a molecular weight of 425.08 g/mol. Its IUPAC name is S-(3-chlorophenyl) (Z,12R)-12-hydroxyoctadec-9-enethioate.
| Compound Name | S-(3-chlorophenyl) (Z,12R)-12-hydroxyoctadec-9-enethioate |
|---|---|
| PubChem CID | 56935545 |
| Molecular Formula | C24H37ClO2S |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | S-(3-chlorophenyl) (Z,12R)-12-hydroxyoctadec-9-enethioate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H37ClO2S/c1-2-3-4-11-16-22(26)17-12-9-7-5-6-8-10-13-19-24(27)28-23-18-14-15-21(25)20-23/h9,12,14-15,18,20,22,26H,2-8,10-11,13,16-17,19H2,1H3/b12-9-/t22-/m1/s1 |
| InChIKey | AYGPWUCIYHHDSG-REBWPMHBSA-N |
| XLogP | 7.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|