C35H66O3 — CID 166138272
(7R,9Z,26Z,29R)-7,29-dihydroxypentatriaconta-9,26-dien-18-one (PubChem CID 166138272) has the molecular formula C35H66O3 and a molecular weight of 534.91 g/mol. Its IUPAC name is (7R,9Z,26Z,29R)-7,29-dihydroxypentatriaconta-9,26-dien-18-one.
| Compound Name | (7R,9Z,26Z,29R)-7,29-dihydroxypentatriaconta-9,26-dien-18-one |
|---|---|
| PubChem CID | 166138272 |
| Molecular Formula | C35H66O3 |
| Molecular Weight | 534.91 g/mol |
| Exact Mass | 534.50 |
| IUPAC Name | (7R,9Z,26Z,29R)-7,29-dihydroxypentatriaconta-9,26-dien-18-one |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)CCCCCCC/C=C\C[C@H](O)CCCCCC |
| InChI | InChI=1S/C35H66O3/c1-3-5-7-21-27-33(36)29-23-17-13-9-11-15-19-25-31-35(38)32-26-20-16-12-10-14-18-24-30-34(37)28-22-8-6-4-2/h17-18,23-24,33-34,36-37H,3-16,19-22,25-32H2,1-2H3/b23-17-,24-18-/t33-,34-/m1/s1 |
| InChIKey | UZSUIYBGQHNOIM-INAQYUPRSA-N |
| XLogP | 10.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.91 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|