C16H22O2S — CID 77102039
4-(4-tert-butylphenyl)sulfanyl-2-ethylbut-2-enoic acid (PubChem CID 77102039) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfanyl-2-ethylbut-2-enoic acid.
| Compound Name | 4-(4-tert-butylphenyl)sulfanyl-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 77102039 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfanyl-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCSc1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C16H22O2S/c1-5-12(15(17)18)10-11-19-14-8-6-13(7-9-14)16(2,3)4/h6-10H,5,11H2,1-4H3,(H,17,18) |
| InChIKey | KDCLPSGQNOHXAY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|