About 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide
2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide (PubChem CID 5145476) has the molecular formula C24H25NOS
and a molecular weight of 375.54 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide |
| PubChem CID | 5145476 |
| Molecular Formula | C24H25NOS |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide |
| SMILES | CC(C)(C)c1ccc(SCC(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NOS/c1-24(2,3)19-14-16-22(17-15-19)27-18-23(26)25(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,18H2,1-3H3 |
| InChIKey | XMROLNXPRJAMTK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide?
The IUPAC name of 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide (CID 5145476) is 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide.
What is the SMILES notation for 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide?
The canonical SMILES for 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide is CC(C)(C)c1ccc(SCC(=O)N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide?
The InChIKey is XMROLNXPRJAMTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NOS/c1-24(2,3)19-14-16-22(17-15-19)27-18-23(26)25(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,18H2,1-3H3.
What are the key properties of 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide?
2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide has a molecular weight of 375.54 g/mol, XLogP of 6.44, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)sulfanyl-N,N-diphenylacetamide is sourced from PubChem (CID 5145476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).