C19H29NOS — CID 4001346
2-(4-tert-butylphenyl)sulfanyl-N-cyclohexyl-N-methylacetamide (PubChem CID 4001346) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 4001346 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)CSc1ccc(C(C)(C)C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C19H29NOS/c1-19(2,3)15-10-12-17(13-11-15)22-14-18(21)20(4)16-8-6-5-7-9-16/h10-13,16H,5-9,14H2,1-4H3 |
| InChIKey | MENGQGYNEIYIEB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |