C17H26N2OS — CID 79128124
2-(4-amino-3-methylphenyl)sulfanyl-N-methyl-N-(4-methylcyclohexyl)acetamide (PubChem CID 79128124) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-(4-amino-3-methylphenyl)sulfanyl-N-methyl-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-(4-amino-3-methylphenyl)sulfanyl-N-methyl-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 79128124 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-(4-amino-3-methylphenyl)sulfanyl-N-methyl-N-(4-methylcyclohexyl)acetamide |
| SMILES | Cc1cc(SCC(=O)N(C)C2CCC(C)CC2)ccc1N |
| InChI | InChI=1S/C17H26N2OS/c1-12-4-6-14(7-5-12)19(3)17(20)11-21-15-8-9-16(18)13(2)10-15/h8-10,12,14H,4-7,11,18H2,1-3H3 |
| InChIKey | IBWSFNCROYDVGU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|