C20H25NO2S — CID 60518633
2-(4-tert-butylphenyl)sulfanyl-N-[(2-hydroxyphenyl)methyl]-N-methylacetamide (PubChem CID 60518633) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-N-[(2-hydroxyphenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-N-[(2-hydroxyphenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 60518633 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-N-[(2-hydroxyphenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccccc1O)C(=O)CSc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25NO2S/c1-20(2,3)16-9-11-17(12-10-16)24-14-19(23)21(4)13-15-7-5-6-8-18(15)22/h5-12,22H,13-14H2,1-4H3 |
| InChIKey | JUACDEFEFZOEJE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|