C20H18N2OS — CID 18894747
2-(3-aminophenyl)sulfanyl-N,N-diphenylacetamide (PubChem CID 18894747) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N,N-diphenylacetamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 18894747 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N,N-diphenylacetamide |
| SMILES | Nc1cccc(SCC(=O)N(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H18N2OS/c21-16-8-7-13-19(14-16)24-15-20(23)22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14H,15,21H2 |
| InChIKey | FNRXKPHEGZSKSH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|