C18H19N5OS+2 — CID 4757133
2-(4,6-diaminopyrimidine-1,3-diium-2-yl)sulfanyl-N,N-diphenylacetamide (PubChem CID 4757133) has the molecular formula C18H19N5OS+2 and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidine-1,3-diium-2-yl)sulfanyl-N,N-diphenylacetamide.
| Compound Name | 2-(4,6-diaminopyrimidine-1,3-diium-2-yl)sulfanyl-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 4757133 |
| Molecular Formula | C18H19N5OS+2 |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-(4,6-diaminopyrimidine-1,3-diium-2-yl)sulfanyl-N,N-diphenylacetamide |
| SMILES | Nc1cc(N)[nH+]c(SCC(=O)N(c2ccccc2)c2ccccc2)[nH+]1 |
| InChI | InChI=1S/C18H17N5OS/c19-15-11-16(20)22-18(21-15)25-12-17(24)23(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11H,12H2,(H4,19,20,21,22)/p+2 |
| InChIKey | FLOUVZVRRSOMBE-UHFFFAOYSA-P |
| XLogP | 1.94 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |